C20H21ClFNO3 — CID 26886374
(E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide (PubChem CID 26886374) has the molecular formula C20H21ClFNO3 and a molecular weight of 377.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26886374 |
| Molecular Formula | C20H21ClFNO3 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(F)cc2C)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C20H21ClFNO3/c1-12(2)26-20-16(21)10-14(11-18(20)25-4)5-8-19(24)23-17-7-6-15(22)9-13(17)3/h5-12H,1-4H3,(H,23,24)/b8-5+ |
| InChIKey | KHHWTQIHLACGAU-VMPITWQZSA-N |
| XLogP | 5.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|