C23H23N5O4S — CID 26893855
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-5-nitro-2-piperidin-1-ylbenzamide (PubChem CID 26893855) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-5-nitro-2-piperidin-1-ylbenzamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-5-nitro-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 26893855 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-5-nitro-2-piperidin-1-ylbenzamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H23N5O4S/c1-15(29)24-17-7-5-16(6-8-17)20-14-33-23(25-20)26-22(30)19-13-18(28(31)32)9-10-21(19)27-11-3-2-4-12-27/h5-10,13-14H,2-4,11-12H2,1H3,(H,24,29)(H,25,26,30) |
| InChIKey | RMAWKXVQGGOBMU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|