C20H17F2NO6 — CID 2689793
(4E)-2-[3-(difluoromethoxy)phenyl]-4-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 2689793) has the molecular formula C20H17F2NO6 and a molecular weight of 405.35 g/mol. Its IUPAC name is (4E)-2-[3-(difluoromethoxy)phenyl]-4-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-[3-(difluoromethoxy)phenyl]-4-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2689793 |
| Molecular Formula | C20H17F2NO6 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (4E)-2-[3-(difluoromethoxy)phenyl]-4-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1/N=C(c2cccc(OC(F)F)c2)OC1=O |
| InChI | InChI=1S/C20H17F2NO6/c1-25-15-10-17(27-3)16(26-2)9-12(15)8-14-19(24)29-18(23-14)11-5-4-6-13(7-11)28-20(21)22/h4-10,20H,1-3H3/b14-8+ |
| InChIKey | IHYARULWJSJVPS-RIYZIHGNSA-N |
| XLogP | 3.66 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|