C22H19N3O3S — CID 2691233
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2691233) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2691233 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)NCc1cccs1 |
| InChI | InChI=1S/C22H19N3O3S/c26-19(23-14-18-12-7-13-29-18)15-25-20(27)22(24-21(25)28,16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-13H,14-15H2,(H,23,26)(H,24,28) |
| InChIKey | RNWPNRFGELTGKA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|