C25H29ClN2O6S — CID 26918191
[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-chloro-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 26918191) has the molecular formula C25H29ClN2O6S and a molecular weight of 521.04 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-chloro-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-chloro-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 26918191 |
| Molecular Formula | C25H29ClN2O6S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-chloro-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(C(=O)OCC(=O)N[C@@H]3CCCc4ccccc43)ccc2Cl)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H29ClN2O6S/c1-16-13-28(14-17(2)34-16)35(31,32)23-12-19(10-11-21(23)26)25(30)33-15-24(29)27-22-9-5-7-18-6-3-4-8-20(18)22/h3-4,6,8,10-12,16-17,22H,5,7,9,13-15H2,1-2H3,(H,27,29)/t16-,17-,22-/m1/s1 |
| InChIKey | KFIUPJFSEHTTRV-DRSNIGMVSA-N |
| XLogP | 3.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |