C13H12N2O5S — CID 26942387
(4-cyano-2-methoxyphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate (PubChem CID 26942387) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate.
| Compound Name | (4-cyano-2-methoxyphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
|---|---|
| PubChem CID | 26942387 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
| SMILES | COc1cc(C#N)ccc1OS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C13H12N2O5S/c1-8-13(9(2)19-15-8)21(16,17)20-11-5-4-10(7-14)6-12(11)18-3/h4-6H,1-3H3 |
| InChIKey | HEJZJFCRGMBRKO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|