C12H7Cl2NO5S — CID 26946627
(2-nitrophenyl) 2,6-dichlorobenzenesulfonate (PubChem CID 26946627) has the molecular formula C12H7Cl2NO5S and a molecular weight of 348.16 g/mol. Its IUPAC name is (2-nitrophenyl) 2,6-dichlorobenzenesulfonate.
| Compound Name | (2-nitrophenyl) 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 26946627 |
| Molecular Formula | C12H7Cl2NO5S |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | (2-nitrophenyl) 2,6-dichlorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccccc1OS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H7Cl2NO5S/c13-8-4-3-5-9(14)12(8)21(18,19)20-11-7-2-1-6-10(11)15(16)17/h1-7H |
| InChIKey | UZEWIIHSQDWYQH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|