C21H18N2O2S — CID 26955894
N-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-phenylthiophene-2-carboxamide (PubChem CID 26955894) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26955894 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c24-19-10-5-12-23(19)17-9-4-8-16(14-17)22-21(25)20-18(11-13-26-20)15-6-2-1-3-7-15/h1-4,6-9,11,13-14H,5,10,12H2,(H,22,25) |
| InChIKey | DXXVZLQROCSHSP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |