C18H18N2O5 — CID 2695601
2-(1,3-benzodioxol-5-ylmethylideneamino)oxy-N-(4-ethoxyphenyl)acetamide (PubChem CID 2695601) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylideneamino)oxy-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylideneamino)oxy-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2695601 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylideneamino)oxy-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CON=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-2-22-15-6-4-14(5-7-15)20-18(21)11-25-19-10-13-3-8-16-17(9-13)24-12-23-16/h3-10H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | SEZJKPSEDXPSPV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|