C23H26N2OS — CID 26958695
N-[[4-(diethylaminomethyl)phenyl]methyl]-3-phenylthiophene-2-carboxamide (PubChem CID 26958695) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26958695 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-3-phenylthiophene-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)c2sccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2OS/c1-3-25(4-2)17-19-12-10-18(11-13-19)16-24-23(26)22-21(14-15-27-22)20-8-6-5-7-9-20/h5-15H,3-4,16-17H2,1-2H3,(H,24,26) |
| InChIKey | WFSJUOXVSCLPDG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |