C24H26N2O2S — CID 56552203
N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-phenylthiophene-2-carboxamide (PubChem CID 56552203) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 56552203 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(CN2CCC(O)CC2)cc1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2S/c27-21-10-13-26(14-11-21)17-19-8-6-18(7-9-19)16-25-24(28)23-22(12-15-29-23)20-4-2-1-3-5-20/h1-9,12,15,21,27H,10-11,13-14,16-17H2,(H,25,28) |
| InChIKey | HTSXVWNCHOFGBL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |