C19H22ClN3O6S2 — CID 26965519
4-chloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 26965519) has the molecular formula C19H22ClN3O6S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 4-chloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26965519 |
| Molecular Formula | C19H22ClN3O6S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 4-chloro-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H22ClN3O6S2/c1-22(15-5-3-2-4-6-15)31(28,29)16-9-7-14(8-10-16)21-30(26,27)17-11-12-18(20)19(13-17)23(24)25/h7-13,15,21H,2-6H2,1H3 |
| InChIKey | SQHIXUBHZZQTLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|