C17H20ClN3O6S2 — CID 26970860
5-[(4-chloro-3-nitrophenyl)sulfonylamino]-N,N-diethyl-2-methylbenzenesulfonamide (PubChem CID 26970860) has the molecular formula C17H20ClN3O6S2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-N,N-diethyl-2-methylbenzenesulfonamide.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-N,N-diethyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 26970860 |
| Molecular Formula | C17H20ClN3O6S2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)sulfonylamino]-N,N-diethyl-2-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)ccc1C |
| InChI | InChI=1S/C17H20ClN3O6S2/c1-4-20(5-2)29(26,27)17-10-13(7-6-12(17)3)19-28(24,25)14-8-9-15(18)16(11-14)21(22)23/h6-11,19H,4-5H2,1-3H3 |
| InChIKey | BJGALCPVROCAGT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|