C19H25N3O6S2 — CID 26488410
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 26488410) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26488410 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NS(=O)(=O)c2cc([N+](=O)[O-])cc(C)c2C)ccc1C |
| InChI | InChI=1S/C19H25N3O6S2/c1-6-21(7-2)30(27,28)18-11-16(9-8-13(18)3)20-29(25,26)19-12-17(22(23)24)10-14(4)15(19)5/h8-12,20H,6-7H2,1-5H3 |
| InChIKey | OQOVIMQHPHXHJT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|