C18H23ClN2O4S2 — CID 51557458
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 51557458) has the molecular formula C18H23ClN2O4S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 51557458 |
| Molecular Formula | C18H23ClN2O4S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NS(=O)(=O)c2ccc(C)cc2C)ccc1Cl |
| InChI | InChI=1S/C18H23ClN2O4S2/c1-5-21(6-2)27(24,25)18-12-15(8-9-16(18)19)20-26(22,23)17-10-7-13(3)11-14(17)4/h7-12,20H,5-6H2,1-4H3 |
| InChIKey | JFGGBNRKZHBVEE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |