C22H28ClN3O4S — CID 55379596
3-acetamido-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)propanamide (PubChem CID 55379596) has the molecular formula C22H28ClN3O4S and a molecular weight of 466.00 g/mol. Its IUPAC name is 3-acetamido-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 55379596 |
| Molecular Formula | C22H28ClN3O4S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 3-acetamido-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CC(NC(C)=O)c2ccc(C)cc2)ccc1Cl |
| InChI | InChI=1S/C22H28ClN3O4S/c1-5-26(6-2)31(29,30)21-13-18(11-12-19(21)23)25-22(28)14-20(24-16(4)27)17-9-7-15(3)8-10-17/h7-13,20H,5-6,14H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | PMCYRYNKWUQBFO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |