C23H24BrN3O2S — CID 26973129
2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]acetamide (PubChem CID 26973129) has the molecular formula C23H24BrN3O2S and a molecular weight of 486.44 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 26973129 |
| Molecular Formula | C23H24BrN3O2S |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)Cc1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C23H24BrN3O2S/c1-26(15-17-5-7-21(8-6-17)27-9-11-29-12-10-27)22(28)14-20-16-30-23(25-20)18-3-2-4-19(24)13-18/h2-8,13,16H,9-12,14-15H2,1H3 |
| InChIKey | LQGBMCLGYHMUNH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|