C22H25N3OS2 — CID 25333543
N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 25333543) has the molecular formula C22H25N3OS2 and a molecular weight of 411.60 g/mol. Its IUPAC name is N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 25333543 |
| Molecular Formula | C22H25N3OS2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C22H25N3OS2/c1-24(14-17-5-7-20(8-6-17)25-10-3-2-4-11-25)21(26)13-19-16-28-22(23-19)18-9-12-27-15-18/h5-9,12,15-16H,2-4,10-11,13-14H2,1H3 |
| InChIKey | GAAISQZHDUCLED-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|