About 4-pentylphenol
4-pentylphenol (PubChem CID 26975) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-pentylphenol.
Molecular Properties
| Compound Name | 4-pentylphenol |
| PubChem CID | 26975 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-pentylphenol |
| SMILES | CCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9,12H,2-5H2,1H3 |
| InChIKey | ZNPSUQQXTRRSBM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentylphenol?
The IUPAC name of 4-pentylphenol (CID 26975) is 4-pentylphenol.
What is the SMILES notation for 4-pentylphenol?
The canonical SMILES for 4-pentylphenol is CCCCCc1ccc(O)cc1.
What is the InChIKey of 4-pentylphenol?
The InChIKey is ZNPSUQQXTRRSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9,12H,2-5H2,1H3.
What are the key properties of 4-pentylphenol?
4-pentylphenol has a molecular weight of 164.25 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentylphenol is sourced from PubChem (CID 26975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).