About 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide
4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide (PubChem CID 26978285) has the molecular formula C19H23BrN2O5S
and a molecular weight of 471.37 g/mol. Its IUPAC name is 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide |
| PubChem CID | 26978285 |
| Molecular Formula | C19H23BrN2O5S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(S(=O)(=O)N(C)C)cc(C)c2C)cc(OC)c1Br |
| InChI | InChI=1S/C19H23BrN2O5S/c1-11-7-14(28(24,25)22(3)4)10-15(12(11)2)21-19(23)13-8-16(26-5)18(20)17(9-13)27-6/h7-10H,1-6H3,(H,21,23) |
| InChIKey | DOEREHUXWPTIII-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide?
The IUPAC name of 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide (CID 26978285) is 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide.
What is the SMILES notation for 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide?
The canonical SMILES for 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide is COc1cc(C(=O)Nc2cc(S(=O)(=O)N(C)C)cc(C)c2C)cc(OC)c1Br.
What is the InChIKey of 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide?
The InChIKey is DOEREHUXWPTIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrN2O5S/c1-11-7-14(28(24,25)22(3)4)10-15(12(11)2)21-19(23)13-8-16(26-5)18(20)17(9-13)27-6/h7-10H,1-6H3,(H,21,23).
What are the key properties of 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide?
4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide has a molecular weight of 471.37 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethoxybenzamide is sourced from PubChem (CID 26978285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).