C19H24N2O3S — CID 27832740
N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethylbenzamide (PubChem CID 27832740) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethylbenzamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 27832740 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2cc(S(=O)(=O)N(C)C)cc(C)c2C)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-12-7-13(2)9-16(8-12)19(22)20-18-11-17(10-14(3)15(18)4)25(23,24)21(5)6/h7-11H,1-6H3,(H,20,22) |
| InChIKey | BIGQTYNHRFNAEO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |