C20H21N3O3S — CID 78812993
N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]quinoline-4-carboxamide (PubChem CID 78812993) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]quinoline-4-carboxamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 78812993 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)cc(NC(=O)c2ccnc3ccccc23)c1C |
| InChI | InChI=1S/C20H21N3O3S/c1-13-11-15(27(25,26)23(3)4)12-19(14(13)2)22-20(24)17-9-10-21-18-8-6-5-7-16(17)18/h5-12H,1-4H3,(H,22,24) |
| InChIKey | TYMUBVRDYFMWIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |