C18H22FN3O2S2 — CID 8561554
1-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 8561554) has the molecular formula C18H22FN3O2S2 and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8561554 |
| Molecular Formula | C18H22FN3O2S2 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(S(=O)(=O)N(C)C)cc(C)c2C)cc1F |
| InChI | InChI=1S/C18H22FN3O2S2/c1-11-6-7-14(9-16(11)19)20-18(25)21-17-10-15(8-12(2)13(17)3)26(23,24)22(4)5/h6-10H,1-5H3,(H2,20,21,25) |
| InChIKey | PLUUGUORUQXCGC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|