C20H25BrN2O3 — CID 2698320
N-(2-bromo-4-methylphenyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetamide (PubChem CID 2698320) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 2698320 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetamide |
| SMILES | CCOc1ccc(CN(C)CC(=O)Nc2ccc(C)cc2Br)cc1OC |
| InChI | InChI=1S/C20H25BrN2O3/c1-5-26-18-9-7-15(11-19(18)25-4)12-23(3)13-20(24)22-17-8-6-14(2)10-16(17)21/h6-11H,5,12-13H2,1-4H3,(H,22,24) |
| InChIKey | NGGOYLRKSQYNJN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |