C17H27N3O4 — CID 8694746
2-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]-methylamino]-N-methylacetamide (PubChem CID 8694746) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 8694746 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]-methylamino]-N-methylacetamide |
| SMILES | CCOc1ccc(CN(C)CC(=O)N(C)CC(=O)NC)cc1OC |
| InChI | InChI=1S/C17H27N3O4/c1-6-24-14-8-7-13(9-15(14)23-5)10-19(3)12-17(22)20(4)11-16(21)18-2/h7-9H,6,10-12H2,1-5H3,(H,18,21) |
| InChIKey | TVLUHGJBGIEBRL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |