C22H29N3O4 — CID 8694848
3-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]amino]-N-ethylbenzamide (PubChem CID 8694848) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 8694848 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[[2-[(4-ethoxy-3-methoxyphenyl)methyl-methylamino]acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN(C)Cc2ccc(OCC)c(OC)c2)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-5-23-22(27)17-8-7-9-18(13-17)24-21(26)15-25(3)14-16-10-11-19(29-6-2)20(12-16)28-4/h7-13H,5-6,14-15H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | LRCHXNZTRXEICN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |