C19H25N4O4+ — CID 2698399
N-(furan-2-ylmethylcarbamoyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2698399) has the molecular formula C19H25N4O4+ and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2698399 |
| Molecular Formula | C19H25N4O4+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1cccc(N2CC[NH+](CC(=O)NC(=O)NCc3ccco3)CC2)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-26-16-5-2-4-15(12-16)23-9-7-22(8-10-23)14-18(24)21-19(25)20-13-17-6-3-11-27-17/h2-6,11-12H,7-10,13-14H2,1H3,(H2,20,21,24,25)/p+1 |
| InChIKey | BLFADMDHECFTPD-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |