C14H10N2O4 — CID 26985153
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl furan-3-carboxylate (PubChem CID 26985153) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl furan-3-carboxylate.
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl furan-3-carboxylate |
|---|---|
| PubChem CID | 26985153 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl furan-3-carboxylate |
| SMILES | O=C(OCc1nc(-c2ccccc2)no1)c1ccoc1 |
| InChI | InChI=1S/C14H10N2O4/c17-14(11-6-7-18-8-11)19-9-12-15-13(16-20-12)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | WGMIQISDQNNMBT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |