C22H22FN5O4 — CID 27001960
[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 3,4-dimethoxy-5-prop-2-enylbenzoate (PubChem CID 27001960) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 3,4-dimethoxy-5-prop-2-enylbenzoate.
| Compound Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 3,4-dimethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 27001960 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 3,4-dimethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)OCc2nc(N)nc(Nc3ccc(F)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22FN5O4/c1-4-5-13-10-14(11-17(30-2)19(13)31-3)20(29)32-12-18-26-21(24)28-22(27-18)25-16-8-6-15(23)7-9-16/h4,6-11H,1,5,12H2,2-3H3,(H3,24,25,26,27,28) |
| InChIKey | XSCVCDUDFLUTAL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|