C23H16NO2S+ — CID 27003564
methyl 11-phenyl-13-thia-11-azoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,14,16-octaene-14-carboxylate (PubChem CID 27003564) has the molecular formula C23H16NO2S+ and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 11-phenyl-13-thia-11-azoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,14,16-octaene-14-carboxylate.
| Compound Name | methyl 11-phenyl-13-thia-11-azoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,14,16-octaene-14-carboxylate |
|---|---|
| PubChem CID | 27003564 |
| Molecular Formula | C23H16NO2S+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | methyl 11-phenyl-13-thia-11-azoniatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,14,16-octaene-14-carboxylate |
| SMILES | COC(=O)c1cc2cc3c4ccccc4ccc3[n+](-c3ccccc3)c2s1 |
| InChI | InChI=1S/C23H16NO2S/c1-26-23(25)21-14-16-13-19-18-10-6-5-7-15(18)11-12-20(19)24(22(16)27-21)17-8-3-2-4-9-17/h2-14H,1H3/q+1 |
| InChIKey | NHSMNYBMFZHALE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|