C21H20N2O3S — CID 2701009
2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 2701009) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2701009 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C21H20N2O3S/c1-3-15-8-4-7-14(2)21(15)22-19(24)13-23-17-11-5-9-16-10-6-12-18(20(16)17)27(23,25)26/h4-12H,3,13H2,1-2H3,(H,22,24) |
| InChIKey | DXEMUPUBFDHQMK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |