C23H21N3O2 — CID 27016148
2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 27016148) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 27016148 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | Cc1cccc2c(=O)n(CC(=O)N[C@@H](C)c3ccc4ccccc4c3)cnc12 |
| InChI | InChI=1S/C23H21N3O2/c1-15-6-5-9-20-22(15)24-14-26(23(20)28)13-21(27)25-16(2)18-11-10-17-7-3-4-8-19(17)12-18/h3-12,14,16H,13H2,1-2H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | SHBSYWFAERZFDZ-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |