C16H21N3O2 — CID 41103569
2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 41103569) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 41103569 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)Cn1cnc2c(C)cccc2c1=O |
| InChI | InChI=1S/C16H21N3O2/c1-4-6-12(3)18-14(20)9-19-10-17-15-11(2)7-5-8-13(15)16(19)21/h5,7-8,10,12H,4,6,9H2,1-3H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | IBGWZFZQUDLOEZ-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |