C20H25N3O6 — CID 33254183
diethyl 2-[4-(8-methyl-4-oxoquinazolin-3-yl)butanoylamino]propanedioate (PubChem CID 33254183) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is diethyl 2-[4-(8-methyl-4-oxoquinazolin-3-yl)butanoylamino]propanedioate.
| Compound Name | diethyl 2-[4-(8-methyl-4-oxoquinazolin-3-yl)butanoylamino]propanedioate |
|---|---|
| PubChem CID | 33254183 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | diethyl 2-[4-(8-methyl-4-oxoquinazolin-3-yl)butanoylamino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)CCCn1cnc2c(C)cccc2c1=O)C(=O)OCC |
| InChI | InChI=1S/C20H25N3O6/c1-4-28-19(26)17(20(27)29-5-2)22-15(24)10-7-11-23-12-21-16-13(3)8-6-9-14(16)18(23)25/h6,8-9,12,17H,4-5,7,10-11H2,1-3H3,(H,22,24) |
| InChIKey | NCZSVKWCRABVAE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|