C20H26N4O3 — CID 47015246
N-(1-acetylpiperidin-4-yl)-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide (PubChem CID 47015246) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 47015246 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide |
| SMILES | CC(=O)N1CCC(NC(=O)CCCn2cnc3c(C)cccc3c2=O)CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-14-5-3-6-17-19(14)21-13-24(20(17)27)10-4-7-18(26)22-16-8-11-23(12-9-16)15(2)25/h3,5-6,13,16H,4,7-12H2,1-2H3,(H,22,26) |
| InChIKey | SFAZUSJTNSLSHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |