C21H27N3O4 — CID 27938357
[2-(cyclooctylamino)-2-oxoethyl] 2-(8-methyl-4-oxoquinazolin-3-yl)acetate (PubChem CID 27938357) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(8-methyl-4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 27938357 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
| SMILES | Cc1cccc2c(=O)n(CC(=O)OCC(=O)NC3CCCCCCC3)cnc12 |
| InChI | InChI=1S/C21H27N3O4/c1-15-8-7-11-17-20(15)22-14-24(21(17)27)12-19(26)28-13-18(25)23-16-9-5-3-2-4-6-10-16/h7-8,11,14,16H,2-6,9-10,12-13H2,1H3,(H,23,25) |
| InChIKey | RHLLKDXMTMCZAM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |