C23H27N3O7S — CID 27019824
(3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27019824) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27019824 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | C=CCc1cc(C(=O)N2CCN(S(=O)(=O)c3cc([N+](=O)[O-])ccc3C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O7S/c1-5-6-17-13-18(14-20(32-3)22(17)33-4)23(27)24-9-11-25(12-10-24)34(30,31)21-15-19(26(28)29)8-7-16(21)2/h5,7-8,13-15H,1,6,9-12H2,2-4H3 |
| InChIKey | SXEQCHFYBANBHX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|