C18H16F3N5O4 — CID 27030526
(2-nitrophenyl)methyl 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate (PubChem CID 27030526) has the molecular formula C18H16F3N5O4 and a molecular weight of 423.35 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate.
| Compound Name | (2-nitrophenyl)methyl 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
|---|---|
| PubChem CID | 27030526 |
| Molecular Formula | C18H16F3N5O4 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (2-nitrophenyl)methyl 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16F3N5O4/c1-10-13(11(2)25-17(22-10)23-16(24-25)18(19,20)21)7-8-15(27)30-9-12-5-3-4-6-14(12)26(28)29/h3-6H,7-9H2,1-2H3 |
| InChIKey | DFNKDJYZCKYJDI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|