C13H15ClN6O3S — CID 27045960
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(4-chloro-2-nitrophenyl)acetamide (PubChem CID 27045960) has the molecular formula C13H15ClN6O3S and a molecular weight of 370.82 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(4-chloro-2-nitrophenyl)acetamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(4-chloro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27045960 |
| Molecular Formula | C13H15ClN6O3S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(4-chloro-2-nitrophenyl)acetamide |
| SMILES | CC(C)(C)n1nnnc1SCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN6O3S/c1-13(2,3)19-12(16-17-18-19)24-7-11(21)15-9-5-4-8(14)6-10(9)20(22)23/h4-6H,7H2,1-3H3,(H,15,21) |
| InChIKey | VXFDLUSRARQLBR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|