C22H22N2O3 — CID 27054675
ethyl (E)-3-[4-(3-indol-1-ylpropanoylamino)phenyl]prop-2-enoate (PubChem CID 27054675) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl (E)-3-[4-(3-indol-1-ylpropanoylamino)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(3-indol-1-ylpropanoylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 27054675 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl (E)-3-[4-(3-indol-1-ylpropanoylamino)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)CCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-2-27-22(26)12-9-17-7-10-19(11-8-17)23-21(25)14-16-24-15-13-18-5-3-4-6-20(18)24/h3-13,15H,2,14,16H2,1H3,(H,23,25)/b12-9+ |
| InChIKey | CFVVXJZWSJEBPI-FMIVXFBMSA-N |
| XLogP | 4.25 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|