C23H26ClN3O3 — CID 55619888
N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-indol-1-ylpropanamide (PubChem CID 55619888) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-indol-1-ylpropanamide.
| Compound Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 55619888 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-indol-1-ylpropanamide |
| SMILES | CCN(CC)C(=O)COc1ccc(NC(=O)CCn2ccc3ccccc32)cc1Cl |
| InChI | InChI=1S/C23H26ClN3O3/c1-3-26(4-2)23(29)16-30-21-10-9-18(15-19(21)24)25-22(28)12-14-27-13-11-17-7-5-6-8-20(17)27/h5-11,13,15H,3-4,12,14,16H2,1-2H3,(H,25,28) |
| InChIKey | QBOBGTJDEXRWAT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |