C17H13ClFN5O3S2 — CID 27067731
N-(4-chloro-3-nitrophenyl)-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 27067731) has the molecular formula C17H13ClFN5O3S2 and a molecular weight of 453.91 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 27067731 |
| Molecular Formula | C17H13ClFN5O3S2 |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(NCc2ccc(F)cc2)s1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClFN5O3S2/c18-13-6-5-12(7-14(13)24(26)27)21-15(25)9-28-17-23-22-16(29-17)20-8-10-1-3-11(19)4-2-10/h1-7H,8-9H2,(H,20,22)(H,21,25) |
| InChIKey | OJKPXNUNNIUVDN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|