C17H15FN4O3S2 — CID 60517593
N-[(4-fluorophenyl)methyl]-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 60517593) has the molecular formula C17H15FN4O3S2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 60517593 |
| Molecular Formula | C17H15FN4O3S2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[2-(2-nitrophenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccccc1OCCSc1nnc(NCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H15FN4O3S2/c18-13-7-5-12(6-8-13)11-19-16-20-21-17(27-16)26-10-9-25-15-4-2-1-3-14(15)22(23)24/h1-8H,9-11H2,(H,19,20) |
| InChIKey | JUTDDEFZVNSOOO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|