C18H13ClF2N2O4 — CID 27073247
(5R)-3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 27073247) has the molecular formula C18H13ClF2N2O4 and a molecular weight of 394.76 g/mol. Its IUPAC name is (5R)-3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 27073247 |
| Molecular Formula | C18H13ClF2N2O4 |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (5R)-3-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc(F)c(F)c2)NC(=O)N(Cc2cc(Cl)c3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C18H13ClF2N2O4/c1-18(10-2-3-12(20)13(21)6-10)16(24)23(17(25)22-18)7-9-4-11(19)15-14(5-9)26-8-27-15/h2-6H,7-8H2,1H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | HESGZYCXCZMEIL-GOSISDBHSA-N |
| XLogP | 3.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|