C19H19N5O2S — CID 2708716
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 2708716) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2708716 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H19N5O2S/c20-16-10-17(21)24-19(23-16)27-12-18(25)22-14-6-8-15(9-7-14)26-11-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,22,25)(H4,20,21,23,24) |
| InChIKey | MMEQLANOFGGVLO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |