C20H18N4O4S — CID 27092151
7-hydroxy-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]-8-methylchromen-2-one (PubChem CID 27092151) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 7-hydroxy-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]-8-methylchromen-2-one.
| Compound Name | 7-hydroxy-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]-8-methylchromen-2-one |
|---|---|
| PubChem CID | 27092151 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 7-hydroxy-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]-8-methylchromen-2-one |
| SMILES | COc1ccc(Cn2nnnc2SCc2cc(=O)oc3c(C)c(O)ccc23)cc1 |
| InChI | InChI=1S/C20H18N4O4S/c1-12-17(25)8-7-16-14(9-18(26)28-19(12)16)11-29-20-21-22-23-24(20)10-13-3-5-15(27-2)6-4-13/h3-9,25H,10-11H2,1-2H3 |
| InChIKey | PZUJSHFHJXARKT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|