C17H15N5OS — CID 27092177
3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]benzonitrile (PubChem CID 27092177) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is 3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 27092177 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylmethyl]benzonitrile |
| SMILES | COc1ccc(Cn2nnnc2SCc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C17H15N5OS/c1-23-16-7-5-13(6-8-16)11-22-17(19-20-21-22)24-12-15-4-2-3-14(9-15)10-18/h2-9H,11-12H2,1H3 |
| InChIKey | NAOAZYVLZQNAPK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |