C12H17N5O3S2 — CID 56803433
N-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylethyl]methanesulfonamide (PubChem CID 56803433) has the molecular formula C12H17N5O3S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylethyl]methanesulfonamide.
| Compound Name | N-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 56803433 |
| Molecular Formula | C12H17N5O3S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylethyl]methanesulfonamide |
| SMILES | COc1ccc(Cn2nnnc2SCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H17N5O3S2/c1-20-11-5-3-10(4-6-11)9-17-12(14-15-16-17)21-8-7-13-22(2,18)19/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | GTSCALPCIUAQHT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|