C25H30N3O3S3+ — CID 27126680
4-[5-[bis(5-morpholin-4-ylthiophen-2-yl)methylidene]thiophen-2-ylidene]morpholin-4-ium (PubChem CID 27126680) has the molecular formula C25H30N3O3S3+ and a molecular weight of 516.73 g/mol. Its IUPAC name is 4-[5-[bis(5-morpholin-4-ylthiophen-2-yl)methylidene]thiophen-2-ylidene]morpholin-4-ium.
| Compound Name | 4-[5-[bis(5-morpholin-4-ylthiophen-2-yl)methylidene]thiophen-2-ylidene]morpholin-4-ium |
|---|---|
| PubChem CID | 27126680 |
| Molecular Formula | C25H30N3O3S3+ |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 4-[5-[bis(5-morpholin-4-ylthiophen-2-yl)methylidene]thiophen-2-ylidene]morpholin-4-ium |
| SMILES | C1=CC(=[N+]2CCOCC2)SC1=C(c1ccc(N2CCOCC2)s1)c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H30N3O3S3/c1-4-22(26-7-13-29-14-8-26)32-19(1)25(20-2-5-23(33-20)27-9-15-30-16-10-27)21-3-6-24(34-21)28-11-17-31-18-12-28/h1-6H,7-18H2/q+1 |
| InChIKey | KDGPFYDRPJJMKL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|