C22H27ClN6O7S3 — CID 43833583
4-[5-[bis(2-morpholin-4-yl-1,3-thiazol-5-yl)methylidene]-1,3-thiazol-2-ylidene]morpholin-4-ium perchlorate (PubChem CID 43833583) has the molecular formula C22H27ClN6O7S3 and a molecular weight of 619.15 g/mol. Its IUPAC name is 4-[5-[bis(2-morpholin-4-yl-1,3-thiazol-5-yl)methylidene]-1,3-thiazol-2-ylidene]morpholin-4-ium perchlorate.
| Compound Name | 4-[5-[bis(2-morpholin-4-yl-1,3-thiazol-5-yl)methylidene]-1,3-thiazol-2-ylidene]morpholin-4-ium perchlorate |
|---|---|
| PubChem CID | 43833583 |
| Molecular Formula | C22H27ClN6O7S3 |
| Molecular Weight | 619.15 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 4-[5-[bis(2-morpholin-4-yl-1,3-thiazol-5-yl)methylidene]-1,3-thiazol-2-ylidene]morpholin-4-ium perchlorate |
| SMILES | C1=NC(=[N+]2CCOCC2)SC1=C(c1cnc(N2CCOCC2)s1)c1cnc(N2CCOCC2)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H27N6O3S3.ClHO4/c1-7-29-8-2-26(1)20-23-13-16(32-20)19(17-14-24-21(33-17)27-3-9-30-10-4-27)18-15-25-22(34-18)28-5-11-31-12-6-28;2-1(3,4)5/h13-15H,1-12H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HILJUFDBXMOITL-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 167.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.15 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|